C14H18O — CID 24744561
6-[1-(4-methylphenyl)ethyl]-3,4-dihydro-2H-pyran (PubChem CID 24744561) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 6-[1-(4-methylphenyl)ethyl]-3,4-dihydro-2H-pyran.
| Compound Name | 6-[1-(4-methylphenyl)ethyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 24744561 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 6-[1-(4-methylphenyl)ethyl]-3,4-dihydro-2H-pyran |
| SMILES | Cc1ccc(C(C)C2=CCCCO2)cc1 |
| InChI | InChI=1S/C14H18O/c1-11-6-8-13(9-7-11)12(2)14-5-3-4-10-15-14/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | LHXPOEZALJSWOZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |