C17H11Cl2FN4OS — CID 24744615
3-(2,4-dichloro-5-fluorophenyl)-6-[(4-methylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 24744615) has the molecular formula C17H11Cl2FN4OS and a molecular weight of 409.27 g/mol. Its IUPAC name is 3-(2,4-dichloro-5-fluorophenyl)-6-[(4-methylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(2,4-dichloro-5-fluorophenyl)-6-[(4-methylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 24744615 |
| Molecular Formula | C17H11Cl2FN4OS |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 3-(2,4-dichloro-5-fluorophenyl)-6-[(4-methylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1ccc(OCc2nn3c(-c4cc(F)c(Cl)cc4Cl)nnc3s2)cc1 |
| InChI | InChI=1S/C17H11Cl2FN4OS/c1-9-2-4-10(5-3-9)25-8-15-23-24-16(21-22-17(24)26-15)11-6-14(20)13(19)7-12(11)18/h2-7H,8H2,1H3 |
| InChIKey | QVXMVBJRJBVDGF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|