C12H7F13N2 — CID 24744629
2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(3,3,4,4,4-pentafluorobutyl)propanedinitrile (PubChem CID 24744629) has the molecular formula C12H7F13N2 and a molecular weight of 426.18 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(3,3,4,4,4-pentafluorobutyl)propanedinitrile.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(3,3,4,4,4-pentafluorobutyl)propanedinitrile |
|---|---|
| PubChem CID | 24744629 |
| Molecular Formula | C12H7F13N2 |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(3,3,4,4,4-pentafluorobutyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)C(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H7F13N2/c13-6(14)10(19,20)11(21,22)9(17,18)3-7(4-26,5-27)1-2-8(15,16)12(23,24)25/h6H,1-3H2 |
| InChIKey | PIDORWGUVHFLRF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|