C26H29N5O2S — CID 24744793
6-(2-acetyl-2,8-diazaspiro[4.5]decan-8-yl)-N-(2-amino-5-thiophen-2-ylphenyl)pyridine-3-carboxamide (PubChem CID 24744793) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is 6-(2-acetyl-2,8-diazaspiro[4.5]decan-8-yl)-N-(2-amino-5-thiophen-2-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 6-(2-acetyl-2,8-diazaspiro[4.5]decan-8-yl)-N-(2-amino-5-thiophen-2-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24744793 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 6-(2-acetyl-2,8-diazaspiro[4.5]decan-8-yl)-N-(2-amino-5-thiophen-2-ylphenyl)pyridine-3-carboxamide |
| SMILES | CC(=O)N1CCC2(CCN(c3ccc(C(=O)Nc4cc(-c5cccs5)ccc4N)cn3)CC2)C1 |
| InChI | InChI=1S/C26H29N5O2S/c1-18(32)31-13-10-26(17-31)8-11-30(12-9-26)24-7-5-20(16-28-24)25(33)29-22-15-19(4-6-21(22)27)23-3-2-14-34-23/h2-7,14-16H,8-13,17,27H2,1H3,(H,29,33) |
| InChIKey | RSSAPDUETMNSKF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|