C27H32N6O2S — CID 24744797
8-[5-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]-2-pyridinyl]-N-ethyl-2,8-diazaspiro[4.5]decane-2-carboxamide (PubChem CID 24744797) has the molecular formula C27H32N6O2S and a molecular weight of 504.66 g/mol. Its IUPAC name is 8-[5-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]-2-pyridinyl]-N-ethyl-2,8-diazaspiro[4.5]decane-2-carboxamide.
| Compound Name | 8-[5-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]-2-pyridinyl]-N-ethyl-2,8-diazaspiro[4.5]decane-2-carboxamide |
|---|---|
| PubChem CID | 24744797 |
| Molecular Formula | C27H32N6O2S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 8-[5-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]-2-pyridinyl]-N-ethyl-2,8-diazaspiro[4.5]decane-2-carboxamide |
| SMILES | CCNC(=O)N1CCC2(CCN(c3ccc(C(=O)Nc4cc(-c5cccs5)ccc4N)cn3)CC2)C1 |
| InChI | InChI=1S/C27H32N6O2S/c1-2-29-26(35)33-14-11-27(18-33)9-12-32(13-10-27)24-8-6-20(17-30-24)25(34)31-22-16-19(5-7-21(22)28)23-4-3-15-36-23/h3-8,15-17H,2,9-14,18,28H2,1H3,(H,29,35)(H,31,34) |
| InChIKey | UZFJLATVXCCZGS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|