About N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide
N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide (PubChem CID 24744806) has the molecular formula C17H19FN2O3S
and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide |
| PubChem CID | 24744806 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide |
| SMILES | CC1(C)CN(c2ccc(F)cc2)c2ccc(NS(C)(=O)=O)cc2O1 |
| InChI | InChI=1S/C17H19FN2O3S/c1-17(2)11-20(14-7-4-12(18)5-8-14)15-9-6-13(10-16(15)23-17)19-24(3,21)22/h4-10,19H,11H2,1-3H3 |
| InChIKey | WPZPTJCDAZMPKJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide?
The IUPAC name of N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide (CID 24744806) is N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide.
What is the SMILES notation for N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide?
The canonical SMILES for N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide is CC1(C)CN(c2ccc(F)cc2)c2ccc(NS(C)(=O)=O)cc2O1.
What is the InChIKey of N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide?
The InChIKey is WPZPTJCDAZMPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN2O3S/c1-17(2)11-20(14-7-4-12(18)5-8-14)15-9-6-13(10-16(15)23-17)19-24(3,21)22/h4-10,19H,11H2,1-3H3.
What are the key properties of N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide?
N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide has a molecular weight of 350.42 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-fluorophenyl)-2,2-dimethyl-3H-1,4-benzoxazin-7-yl]methanesulfonamide is sourced from PubChem (CID 24744806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).