C14H16O3 — CID 24745896
(1S,3S,7R,8R,10R,11R)-10-hydroxy-5,8-dimethyl-9-methylidene-12-oxatetracyclo[6.4.0.01,11.03,7]dodec-4-en-6-one (PubChem CID 24745896) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (1S,3S,7R,8R,10R,11R)-10-hydroxy-5,8-dimethyl-9-methylidene-12-oxatetracyclo[6.4.0.01,11.03,7]dodec-4-en-6-one.
| Compound Name | (1S,3S,7R,8R,10R,11R)-10-hydroxy-5,8-dimethyl-9-methylidene-12-oxatetracyclo[6.4.0.01,11.03,7]dodec-4-en-6-one |
|---|---|
| PubChem CID | 24745896 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (1S,3S,7R,8R,10R,11R)-10-hydroxy-5,8-dimethyl-9-methylidene-12-oxatetracyclo[6.4.0.01,11.03,7]dodec-4-en-6-one |
| SMILES | C=C1[C@@H](O)[C@H]2O[C@]23C[C@H]2C=C(C)C(=O)[C@H]2[C@]13C |
| InChI | InChI=1S/C14H16O3/c1-6-4-8-5-14-12(17-14)11(16)7(2)13(14,3)9(8)10(6)15/h4,8-9,11-12,16H,2,5H2,1,3H3/t8-,9+,11-,12-,13+,14-/m1/s1 |
| InChIKey | JRDLQSLNJLZYQK-MBVKLORRSA-N |
| XLogP | 1.23 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|