C24H27N5OS — CID 24746436
N-(2-amino-5-thiophen-3-ylphenyl)-6-(2,8-diazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide (PubChem CID 24746436) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-3-ylphenyl)-6-(2,8-diazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-3-ylphenyl)-6-(2,8-diazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24746436 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-(2-amino-5-thiophen-3-ylphenyl)-6-(2,8-diazaspiro[4.5]decan-8-yl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(-c2ccsc2)cc1NC(=O)c1ccc(N2CCC3(CCNC3)CC2)nc1 |
| InChI | InChI=1S/C24H27N5OS/c25-20-3-1-17(19-5-12-31-15-19)13-21(20)28-23(30)18-2-4-22(27-14-18)29-10-7-24(8-11-29)6-9-26-16-24/h1-5,12-15,26H,6-11,16,25H2,(H,28,30) |
| InChIKey | TUVQBCVIGSAMTQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|