C25H25F2N3O4 — CID 24746456
[3-amino-2-[2-methyl-4-(2-morpholin-4-ylethoxy)phenyl]-1-oxidopyridin-1-ium-4-yl]-(2,4-difluorophenyl)methanone (PubChem CID 24746456) has the molecular formula C25H25F2N3O4 and a molecular weight of 469.49 g/mol. Its IUPAC name is [3-amino-2-[2-methyl-4-(2-morpholin-4-ylethoxy)phenyl]-1-oxidopyridin-1-ium-4-yl]-(2,4-difluorophenyl)methanone.
| Compound Name | [3-amino-2-[2-methyl-4-(2-morpholin-4-ylethoxy)phenyl]-1-oxidopyridin-1-ium-4-yl]-(2,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 24746456 |
| Molecular Formula | C25H25F2N3O4 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | [3-amino-2-[2-methyl-4-(2-morpholin-4-ylethoxy)phenyl]-1-oxidopyridin-1-ium-4-yl]-(2,4-difluorophenyl)methanone |
| SMILES | Cc1cc(OCCN2CCOCC2)ccc1-c1c(N)c(C(=O)c2ccc(F)cc2F)cc[n+]1[O-] |
| InChI | InChI=1S/C25H25F2N3O4/c1-16-14-18(34-13-10-29-8-11-33-12-9-29)3-5-19(16)24-23(28)21(6-7-30(24)32)25(31)20-4-2-17(26)15-22(20)27/h2-7,14-15H,8-13,28H2,1H3 |
| InChIKey | PRIXMKFORFZRFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|