C16H18N4O3S — CID 2474646
8-methyl-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2474646) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 8-methyl-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methyl-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2474646 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 8-methyl-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(Cc1nnc(-c3cccs3)o1)C2=O |
| InChI | InChI=1S/C16H18N4O3S/c1-10-4-6-16(7-5-10)14(21)20(15(22)17-16)9-12-18-19-13(23-12)11-3-2-8-24-11/h2-3,8,10H,4-7,9H2,1H3,(H,17,22) |
| InChIKey | SVFSOGPAVDRLLP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|