About ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate
ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate (PubChem CID 24746546) has the molecular formula C28H52N2O7
and a molecular weight of 528.73 g/mol. Its IUPAC name is ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate.
Molecular Properties
| Compound Name | ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate |
| PubChem CID | 24746546 |
| Molecular Formula | C28H52N2O7 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)NC(=O)CCCCCN |
| InChI | InChI=1S/C28H52N2O7/c1-25(2,3)35-22(32)14-17-28(18-15-23(33)36-26(4,5)6,19-16-24(34)37-27(7,8)9)30-21(31)13-11-10-12-20-29/h10-20,29H2,1-9H3,(H,30,31) |
| InChIKey | LCCIKDFVEWGPSV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate?
The IUPAC name of ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate (CID 24746546) is ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate.
What is the SMILES notation for ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate?
The canonical SMILES for ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate is CC(C)(C)OC(=O)CCC(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)NC(=O)CCCCCN.
What is the InChIKey of ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate?
The InChIKey is LCCIKDFVEWGPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H52N2O7/c1-25(2,3)35-22(32)14-17-28(18-15-23(33)36-26(4,5)6,19-16-24(34)37-27(7,8)9)30-21(31)13-11-10-12-20-29/h10-20,29H2,1-9H3,(H,30,31).
What are the key properties of ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate?
ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate has a molecular weight of 528.73 g/mol, XLogP of 4.73, 15 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 4-(6-aminohexanoylamino)-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate is sourced from PubChem (CID 24746546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).