C18H30O5 — CID 24746682
prop-2-enyl (2R,3R,4S)-4-tert-butyl-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 24746682) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is prop-2-enyl (2R,3R,4S)-4-tert-butyl-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | prop-2-enyl (2R,3R,4S)-4-tert-butyl-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 24746682 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | prop-2-enyl (2R,3R,4S)-4-tert-butyl-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C[C@H](C(C)(C)C)[C@@H](CCCO)[C@H](OCC)O1 |
| InChI | InChI=1S/C18H30O5/c1-6-11-22-16(20)15-12-14(18(3,4)5)13(9-8-10-19)17(23-15)21-7-2/h6,12-14,17,19H,1,7-11H2,2-5H3/t13-,14+,17-/m1/s1 |
| InChIKey | LKAVYBCCIVHXNN-JKIFEVAISA-N |
| XLogP | 3.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|