C15H23NO4 — CID 24746728
(2S,3S,4R)-2-ethoxy-3-(3-hydroxypropyl)-4-methyl-N-prop-2-ynyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 24746728) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2S,3S,4R)-2-ethoxy-3-(3-hydroxypropyl)-4-methyl-N-prop-2-ynyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3S,4R)-2-ethoxy-3-(3-hydroxypropyl)-4-methyl-N-prop-2-ynyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 24746728 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2S,3S,4R)-2-ethoxy-3-(3-hydroxypropyl)-4-methyl-N-prop-2-ynyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | C#CCNC(=O)C1=C[C@@H](C)[C@H](CCCO)[C@@H](OCC)O1 |
| InChI | InChI=1S/C15H23NO4/c1-4-8-16-14(18)13-10-11(3)12(7-6-9-17)15(20-13)19-5-2/h1,10-12,15,17H,5-9H2,2-3H3,(H,16,18)/t11-,12+,15+/m1/s1 |
| InChIKey | LBVFVAMICIVAMZ-XUJVJEKNSA-N |
| XLogP | 1.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|