About (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one
(2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one (PubChem CID 24746756) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one.
Molecular Properties
| Compound Name | (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one |
| PubChem CID | 24746756 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one |
| SMILES | COC(C[C@H]1O[C@@H]1C(=O)[C@H](C)OCc1ccccc1)OC |
| InChI | InChI=1S/C16H22O5/c1-11(20-10-12-7-5-4-6-8-12)15(17)16-13(21-16)9-14(18-2)19-3/h4-8,11,13-14,16H,9-10H2,1-3H3/t11-,13+,16-/m0/s1 |
| InChIKey | ZOBBKJUVSAWLEA-GHJWDPDVSA-N |
| XLogP | 1.94 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one?
The IUPAC name of (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one (CID 24746756) is (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one.
What is the SMILES notation for (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one?
The canonical SMILES for (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one is COC(C[C@H]1O[C@@H]1C(=O)[C@H](C)OCc1ccccc1)OC.
What is the InChIKey of (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one?
The InChIKey is ZOBBKJUVSAWLEA-GHJWDPDVSA-N. The full InChI is InChI=1S/C16H22O5/c1-11(20-10-12-7-5-4-6-8-12)15(17)16-13(21-16)9-14(18-2)19-3/h4-8,11,13-14,16H,9-10H2,1-3H3/t11-,13+,16-/m0/s1.
What are the key properties of (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one?
(2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one has a molecular weight of 294.35 g/mol, XLogP of 1.94, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxypropan-1-one is sourced from PubChem (CID 24746756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).