About N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride
N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 24746811) has the molecular formula C16H22ClN3S
and a molecular weight of 323.89 g/mol. Its IUPAC name is N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride |
| PubChem CID | 24746811 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | Cc1cc(C)nc(SCCCNCc2ccccc2)n1.Cl |
| InChI | InChI=1S/C16H21N3S.ClH/c1-13-11-14(2)19-16(18-13)20-10-6-9-17-12-15-7-4-3-5-8-15;/h3-5,7-8,11,17H,6,9-10,12H2,1-2H3;1H |
| InChIKey | ROMYWMOAZJGOPQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride?
The IUPAC name of N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride (CID 24746811) is N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride.
What is the SMILES notation for N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride?
The canonical SMILES for N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride is Cc1cc(C)nc(SCCCNCc2ccccc2)n1.Cl.
What is the InChIKey of N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride?
The InChIKey is ROMYWMOAZJGOPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3S.ClH/c1-13-11-14(2)19-16(18-13)20-10-6-9-17-12-15-7-4-3-5-8-15;/h3-5,7-8,11,17H,6,9-10,12H2,1-2H3;1H.
What are the key properties of N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride?
N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride has a molecular weight of 323.89 g/mol, XLogP of 3.79, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropan-1-amine;hydrochloride is sourced from PubChem (CID 24746811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).