C17H24ClN3S — CID 24746819
3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(4-methylphenyl)methyl]propan-1-amine;hydrochloride (PubChem CID 24746819) has the molecular formula C17H24ClN3S and a molecular weight of 337.92 g/mol. Its IUPAC name is 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(4-methylphenyl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(4-methylphenyl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 24746819 |
| Molecular Formula | C17H24ClN3S |
| Molecular Weight | 337.92 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(4-methylphenyl)methyl]propan-1-amine;hydrochloride |
| SMILES | Cc1ccc(CNCCCSc2nc(C)cc(C)n2)cc1.Cl |
| InChI | InChI=1S/C17H23N3S.ClH/c1-13-5-7-16(8-6-13)12-18-9-4-10-21-17-19-14(2)11-15(3)20-17;/h5-8,11,18H,4,9-10,12H2,1-3H3;1H |
| InChIKey | OOGASYRDPUVTKA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|