About 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride
1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride (PubChem CID 24746841) has the molecular formula C19H24ClN3O3
and a molecular weight of 377.87 g/mol. Its IUPAC name is 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride |
| PubChem CID | 24746841 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride |
| SMILES | CCn1c(NCc2cc(OC)c(OC)c(OC)c2)nc2ccccc21.Cl |
| InChI | InChI=1S/C19H23N3O3.ClH/c1-5-22-15-9-7-6-8-14(15)21-19(22)20-12-13-10-16(23-2)18(25-4)17(11-13)24-3;/h6-11H,5,12H2,1-4H3,(H,20,21);1H |
| InChIKey | OQHDGSWSNRWUAX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride?
The IUPAC name of 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride (CID 24746841) is 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride.
What is the SMILES notation for 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride?
The canonical SMILES for 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride is CCn1c(NCc2cc(OC)c(OC)c(OC)c2)nc2ccccc21.Cl.
What is the InChIKey of 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride?
The InChIKey is OQHDGSWSNRWUAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3.ClH/c1-5-22-15-9-7-6-8-14(15)21-19(22)20-12-13-10-16(23-2)18(25-4)17(11-13)24-3;/h6-11H,5,12H2,1-4H3,(H,20,21);1H.
What are the key properties of 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride?
1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride has a molecular weight of 377.87 g/mol, XLogP of 4.12, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-2-amine;hydrochloride is sourced from PubChem (CID 24746841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).