About 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide
2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide (PubChem CID 24746870) has the molecular formula C21H22INO2
and a molecular weight of 447.32 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide.
Molecular Properties
| Compound Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide |
| PubChem CID | 24746870 |
| Molecular Formula | C21H22INO2 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide |
| SMILES | CC[n+]1c(/C=C/c2ccc(OC)c(OC)c2)ccc2ccccc21.[I-] |
| InChI | InChI=1S/C21H22NO2.HI/c1-4-22-18(13-11-17-7-5-6-8-19(17)22)12-9-16-10-14-20(23-2)21(15-16)24-3;/h5-15H,4H2,1-3H3;1H/q+1;/p-1/b12-9+; |
| InChIKey | QUQVOSBXCLDQGE-NBYYMMLRSA-M |
| XLogP | 1.34 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide?
The IUPAC name of 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide (CID 24746870) is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide.
What is the SMILES notation for 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide?
The canonical SMILES for 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide is CC[n+]1c(/C=C/c2ccc(OC)c(OC)c2)ccc2ccccc21.[I-].
What is the InChIKey of 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide?
The InChIKey is QUQVOSBXCLDQGE-NBYYMMLRSA-M. The full InChI is InChI=1S/C21H22NO2.HI/c1-4-22-18(13-11-17-7-5-6-8-19(17)22)12-9-16-10-14-20(23-2)21(15-16)24-3;/h5-15H,4H2,1-3H3;1H/q+1;/p-1/b12-9+;.
What are the key properties of 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide?
2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide has a molecular weight of 447.32 g/mol, XLogP of 1.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylquinolin-1-ium iodide is sourced from PubChem (CID 24746870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).