C14H14N4O2S2 — CID 24746878
1-(3-acetylphenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)urea (PubChem CID 24746878) has the molecular formula C14H14N4O2S2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)urea.
| Compound Name | 1-(3-acetylphenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 24746878 |
| Molecular Formula | C14H14N4O2S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-(3-acetylphenyl)-3-(3-prop-2-enylsulfanyl-1,2,4-thiadiazol-5-yl)urea |
| SMILES | C=CCSc1nsc(NC(=O)Nc2cccc(C(C)=O)c2)n1 |
| InChI | InChI=1S/C14H14N4O2S2/c1-3-7-21-14-17-13(22-18-14)16-12(20)15-11-6-4-5-10(8-11)9(2)19/h3-6,8H,1,7H2,2H3,(H2,15,16,17,18,20) |
| InChIKey | PSSJOGLFMBGWOB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|