About 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide
2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide (PubChem CID 24746944) has the molecular formula C20H30N4O
and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide |
| PubChem CID | 24746944 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCC(c2nc3cc(C)c(C)cc3[nH]2)CC1 |
| InChI | InChI=1S/C20H30N4O/c1-5-24(6-2)19(25)13-23-9-7-16(8-10-23)20-21-17-11-14(3)15(4)12-18(17)22-20/h11-12,16H,5-10,13H2,1-4H3,(H,21,22) |
| InChIKey | BHVXERHCEQVUGA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide?
The IUPAC name of 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide (CID 24746944) is 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide.
What is the SMILES notation for 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide?
The canonical SMILES for 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide is CCN(CC)C(=O)CN1CCC(c2nc3cc(C)c(C)cc3[nH]2)CC1.
What is the InChIKey of 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide?
The InChIKey is BHVXERHCEQVUGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4O/c1-5-24(6-2)19(25)13-23-9-7-16(8-10-23)20-21-17-11-14(3)15(4)12-18(17)22-20/h11-12,16H,5-10,13H2,1-4H3,(H,21,22).
What are the key properties of 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide?
2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide has a molecular weight of 342.49 g/mol, XLogP of 3.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5,6-dimethyl-1H-benzimidazol-2-yl)piperidin-1-yl]-N,N-diethylacetamide is sourced from PubChem (CID 24746944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).