C22H31N3O6 — CID 24746961
2-(4-methylpiperidin-1-yl)-N-[4-(piperidine-1-carbonyl)phenyl]acetamide;oxalic acid (PubChem CID 24746961) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-N-[4-(piperidine-1-carbonyl)phenyl]acetamide;oxalic acid.
| Compound Name | 2-(4-methylpiperidin-1-yl)-N-[4-(piperidine-1-carbonyl)phenyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 24746961 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-N-[4-(piperidine-1-carbonyl)phenyl]acetamide;oxalic acid |
| SMILES | CC1CCN(CC(=O)Nc2ccc(C(=O)N3CCCCC3)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H29N3O2.C2H2O4/c1-16-9-13-22(14-10-16)15-19(24)21-18-7-5-17(6-8-18)20(25)23-11-3-2-4-12-23;3-1(4)2(5)6/h5-8,16H,2-4,9-15H2,1H3,(H,21,24);(H,3,4)(H,5,6) |
| InChIKey | SCZIGWACJLTBLI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|