About 1-piperidin-4-ylazepane;hydrochloride
1-piperidin-4-ylazepane;hydrochloride (PubChem CID 24747019) has the molecular formula C11H23ClN2
and a molecular weight of 218.77 g/mol. Its IUPAC name is 1-piperidin-4-ylazepane;hydrochloride.
Molecular Properties
| Compound Name | 1-piperidin-4-ylazepane;hydrochloride |
| PubChem CID | 24747019 |
| Molecular Formula | C11H23ClN2 |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-piperidin-4-ylazepane;hydrochloride |
| SMILES | C1CCCN(C2CCNCC2)CC1.Cl |
| InChI | InChI=1S/C11H22N2.ClH/c1-2-4-10-13(9-3-1)11-5-7-12-8-6-11;/h11-12H,1-10H2;1H |
| InChIKey | GWDGTEZHNXFQAH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-piperidin-4-ylazepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-ylazepane;hydrochloride?
The IUPAC name of 1-piperidin-4-ylazepane;hydrochloride (CID 24747019) is 1-piperidin-4-ylazepane;hydrochloride.
What is the SMILES notation for 1-piperidin-4-ylazepane;hydrochloride?
The canonical SMILES for 1-piperidin-4-ylazepane;hydrochloride is C1CCCN(C2CCNCC2)CC1.Cl.
What is the InChIKey of 1-piperidin-4-ylazepane;hydrochloride?
The InChIKey is GWDGTEZHNXFQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.ClH/c1-2-4-10-13(9-3-1)11-5-7-12-8-6-11;/h11-12H,1-10H2;1H.
What are the key properties of 1-piperidin-4-ylazepane;hydrochloride?
1-piperidin-4-ylazepane;hydrochloride has a molecular weight of 218.77 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-ylazepane;hydrochloride is sourced from PubChem (CID 24747019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).