C11H12ClN3O3S — CID 24747061
N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-3-nitrobenzamide;hydrochloride (PubChem CID 24747061) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.75 g/mol. Its IUPAC name is N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-3-nitrobenzamide;hydrochloride.
| Compound Name | N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 24747061 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)-3-nitrobenzamide;hydrochloride |
| SMILES | CC1CN=C(NC(=O)c2cccc([N+](=O)[O-])c2)S1.Cl |
| InChI | InChI=1S/C11H11N3O3S.ClH/c1-7-6-12-11(18-7)13-10(15)8-3-2-4-9(5-8)14(16)17;/h2-5,7H,6H2,1H3,(H,12,13,15);1H |
| InChIKey | SYXCVGGTVAIMSG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|