About 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride
4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride (PubChem CID 24747132) has the molecular formula C14H13ClN2O2
and a molecular weight of 276.72 g/mol. Its IUPAC name is 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride.
Molecular Properties
| Compound Name | 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride |
| PubChem CID | 24747132 |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride |
| SMILES | Cc1ccc2nc(-c3ccc(O)c(O)c3)cn2c1.Cl |
| InChI | InChI=1S/C14H12N2O2.ClH/c1-9-2-5-14-15-11(8-16(14)7-9)10-3-4-12(17)13(18)6-10;/h2-8,17-18H,1H3;1H |
| InChIKey | YWAYDKKWJDMLAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride?
The IUPAC name of 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride (CID 24747132) is 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride.
What is the SMILES notation for 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride?
The canonical SMILES for 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride is Cc1ccc2nc(-c3ccc(O)c(O)c3)cn2c1.Cl.
What is the InChIKey of 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride?
The InChIKey is YWAYDKKWJDMLAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2.ClH/c1-9-2-5-14-15-11(8-16(14)7-9)10-3-4-12(17)13(18)6-10;/h2-8,17-18H,1H3;1H.
What are the key properties of 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride?
4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride has a molecular weight of 276.72 g/mol, XLogP of 3.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methylimidazo[1,2-a]pyridin-2-yl)benzene-1,2-diol;hydrochloride is sourced from PubChem (CID 24747132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).