C21H27N3O6S — CID 24747171
methyl (1R,5S)-8-(2-acetamidoethylcarbamoyl)-3-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate (PubChem CID 24747171) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is methyl (1R,5S)-8-(2-acetamidoethylcarbamoyl)-3-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate.
| Compound Name | methyl (1R,5S)-8-(2-acetamidoethylcarbamoyl)-3-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 24747171 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | methyl (1R,5S)-8-(2-acetamidoethylcarbamoyl)-3-(4-methylsulfonylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C(c2ccc(S(C)(=O)=O)cc2)C[C@@H]2CC[C@H]1N2C(=O)NCCNC(C)=O |
| InChI | InChI=1S/C21H27N3O6S/c1-13(25)22-10-11-23-21(27)24-15-6-9-18(24)19(20(26)30-2)17(12-15)14-4-7-16(8-5-14)31(3,28)29/h4-5,7-8,15,18H,6,9-12H2,1-3H3,(H,22,25)(H,23,27)/t15-,18+/m0/s1 |
| InChIKey | NUKMQUYMDUQDSR-MAUKXSAKSA-N |
| XLogP | 1.10 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|