C33H30N2O9 — CID 24747211
[3,4-dibenzoyloxy-5-(2,4-dioxo-5-propan-2-ylpyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 24747211) has the molecular formula C33H30N2O9 and a molecular weight of 598.61 g/mol. Its IUPAC name is [3,4-dibenzoyloxy-5-(2,4-dioxo-5-propan-2-ylpyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [3,4-dibenzoyloxy-5-(2,4-dioxo-5-propan-2-ylpyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 24747211 |
| Molecular Formula | C33H30N2O9 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | [3,4-dibenzoyloxy-5-(2,4-dioxo-5-propan-2-ylpyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | CC(C)c1cn(C2OC(COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H30N2O9/c1-20(2)24-18-35(33(40)34-28(24)36)29-27(44-32(39)23-16-10-5-11-17-23)26(43-31(38)22-14-8-4-9-15-22)25(42-29)19-41-30(37)21-12-6-3-7-13-21/h3-18,20,25-27,29H,19H2,1-2H3,(H,34,36,40) |
| InChIKey | GCKODGMYILQELF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|