About 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid
4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid (PubChem CID 24747242) has the molecular formula C16H12N2O4
and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| PubChem CID | 24747242 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| SMILES | COc1ccc(-c2nc(-c3ccc(C(=O)O)cc3)no2)cc1 |
| InChI | InChI=1S/C16H12N2O4/c1-21-13-8-6-11(7-9-13)15-17-14(18-22-15)10-2-4-12(5-3-10)16(19)20/h2-9H,1H3,(H,19,20) |
| InChIKey | YJTODMGESCYDSI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid?
The IUPAC name of 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CID 24747242) is 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid.
What is the SMILES notation for 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid?
The canonical SMILES for 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid is COc1ccc(-c2nc(-c3ccc(C(=O)O)cc3)no2)cc1.
What is the InChIKey of 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid?
The InChIKey is YJTODMGESCYDSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O4/c1-21-13-8-6-11(7-9-13)15-17-14(18-22-15)10-2-4-12(5-3-10)16(19)20/h2-9H,1H3,(H,19,20).
What are the key properties of 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid?
4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid has a molecular weight of 296.28 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid is sourced from PubChem (CID 24747242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).