C16H9F3N2O3 — CID 24747338
4-[5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoic acid (PubChem CID 24747338) has the molecular formula C16H9F3N2O3 and a molecular weight of 334.25 g/mol. Its IUPAC name is 4-[5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoic acid.
| Compound Name | 4-[5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 24747338 |
| Molecular Formula | C16H9F3N2O3 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 4-[5-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2noc(-c3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C16H9F3N2O3/c17-16(18,19)12-3-1-2-11(8-12)14-20-13(21-24-14)9-4-6-10(7-5-9)15(22)23/h1-8H,(H,22,23) |
| InChIKey | CIVCXVHZHOVCDJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |