C23H25N3O2 — CID 24747359
(4aS,8R,8aS)-2-benzyl-1-oxo-N-(pyridin-3-ylmethyl)-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide (PubChem CID 24747359) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (4aS,8R,8aS)-2-benzyl-1-oxo-N-(pyridin-3-ylmethyl)-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide.
| Compound Name | (4aS,8R,8aS)-2-benzyl-1-oxo-N-(pyridin-3-ylmethyl)-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 24747359 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (4aS,8R,8aS)-2-benzyl-1-oxo-N-(pyridin-3-ylmethyl)-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1CC=C[C@@H]2CCN(Cc3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C23H25N3O2/c27-22(25-15-18-8-5-12-24-14-18)20-10-4-9-19-11-13-26(23(28)21(19)20)16-17-6-2-1-3-7-17/h1-9,12,14,19-21H,10-11,13,15-16H2,(H,25,27)/t19-,20-,21+/m1/s1 |
| InChIKey | PMMNKUWMSUZIFG-NJYVYQBISA-N |
| XLogP | 2.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|