C16H21NO3S — CID 24747367
1-[(3S)-2-cyclohexyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one (PubChem CID 24747367) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-[(3S)-2-cyclohexyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one.
| Compound Name | 1-[(3S)-2-cyclohexyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one |
|---|---|
| PubChem CID | 24747367 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[(3S)-2-cyclohexyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1c2ccccc2S(=O)(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C16H21NO3S/c1-12(18)11-15-14-9-5-6-10-16(14)21(19,20)17(15)13-7-3-2-4-8-13/h5-6,9-10,13,15H,2-4,7-8,11H2,1H3/t15-/m0/s1 |
| InChIKey | FOAISFWAALSLSI-HNNXBMFYSA-N |
| XLogP | 3.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |