C24H26N2O3 — CID 24747376
(4aS,8R,8aS)-2-benzyl-N-(4-methoxyphenyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide (PubChem CID 24747376) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is (4aS,8R,8aS)-2-benzyl-N-(4-methoxyphenyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide.
| Compound Name | (4aS,8R,8aS)-2-benzyl-N-(4-methoxyphenyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 24747376 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (4aS,8R,8aS)-2-benzyl-N-(4-methoxyphenyl)-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2CC=C[C@@H]3CCN(Cc4ccccc4)C(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-29-20-12-10-19(11-13-20)25-23(27)21-9-5-8-18-14-15-26(24(28)22(18)21)16-17-6-3-2-4-7-17/h2-8,10-13,18,21-22H,9,14-16H2,1H3,(H,25,27)/t18-,21-,22+/m1/s1 |
| InChIKey | KKGBTCOOCSRKEY-QIJUGHKUSA-N |
| XLogP | 3.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|