About ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate
ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (PubChem CID 24747379) has the molecular formula C15H20FNO4S
and a molecular weight of 329.39 g/mol. Its IUPAC name is ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| PubChem CID | 24747379 |
| Molecular Formula | C15H20FNO4S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1c2cc(F)ccc2S(=O)(=O)N1C(C)(C)C |
| InChI | InChI=1S/C15H20FNO4S/c1-5-21-14(18)9-12-11-8-10(16)6-7-13(11)22(19,20)17(12)15(2,3)4/h6-8,12H,5,9H2,1-4H3/t12-/m0/s1 |
| InChIKey | OCZLCXAHSPEJAF-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The IUPAC name of ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (CID 24747379) is ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
What is the SMILES notation for ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The canonical SMILES for ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate is CCOC(=O)C[C@H]1c2cc(F)ccc2S(=O)(=O)N1C(C)(C)C.
What is the InChIKey of ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The InChIKey is OCZLCXAHSPEJAF-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H20FNO4S/c1-5-21-14(18)9-12-11-8-10(16)6-7-13(11)22(19,20)17(12)15(2,3)4/h6-8,12H,5,9H2,1-4H3/t12-/m0/s1.
What are the key properties of ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate has a molecular weight of 329.39 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3S)-2-tert-butyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate is sourced from PubChem (CID 24747379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).