C15H19NO4S — CID 24747380
2-[(3S)-2-cyclohexyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid (PubChem CID 24747380) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[(3S)-2-cyclohexyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[(3S)-2-cyclohexyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 24747380 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[(3S)-2-cyclohexyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1c2ccccc2S(=O)(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C15H19NO4S/c17-15(18)10-13-12-8-4-5-9-14(12)21(19,20)16(13)11-6-2-1-3-7-11/h4-5,8-9,11,13H,1-3,6-7,10H2,(H,17,18)/t13-/m0/s1 |
| InChIKey | FECAREAXXGJNMX-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |