C17H24FNO4S — CID 24747384
2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid (PubChem CID 24747384) has the molecular formula C17H24FNO4S and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 24747384 |
| Molecular Formula | C17H24FNO4S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid |
| SMILES | CCCCCCCCN1[C@@H](CC(=O)O)c2cc(F)ccc2S1(=O)=O |
| InChI | InChI=1S/C17H24FNO4S/c1-2-3-4-5-6-7-10-19-15(12-17(20)21)14-11-13(18)8-9-16(14)24(19,22)23/h8-9,11,15H,2-7,10,12H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | UQRFGJCJFUXEOJ-HNNXBMFYSA-N |
| XLogP | 3.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|