C11H16N2O5S — CID 24747406
dimethyl (7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate (PubChem CID 24747406) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is dimethyl (7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate.
| Compound Name | dimethyl (7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 24747406 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | dimethyl (7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
| SMILES | COC(=O)C1NC(=O)N2C(C(=O)OC)C(C)(C)S[C@H]12 |
| InChI | InChI=1S/C11H16N2O5S/c1-11(2)6(9(15)18-4)13-7(19-11)5(8(14)17-3)12-10(13)16/h5-7H,1-4H3,(H,12,16)/t5?,6?,7-/m1/s1 |
| InChIKey | UVGDYAIYANJGJQ-KPGICGJXSA-N |
| XLogP | -0.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |