About N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide
N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide (PubChem CID 24747414) has the molecular formula C10H13BrN2S
and a molecular weight of 273.20 g/mol. Its IUPAC name is N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide.
Molecular Properties
| Compound Name | N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide |
| PubChem CID | 24747414 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide |
| SMILES | Br.c1ccc(NC2=NCCCS2)cc1 |
| InChI | InChI=1S/C10H12N2S.BrH/c1-2-5-9(6-3-1)12-10-11-7-4-8-13-10;/h1-3,5-6H,4,7-8H2,(H,11,12);1H |
| InChIKey | WUFSJACWBHRPRJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide?
The IUPAC name of N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide (CID 24747414) is N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide.
What is the SMILES notation for N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide?
The canonical SMILES for N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide is Br.c1ccc(NC2=NCCCS2)cc1.
What is the InChIKey of N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide?
The InChIKey is WUFSJACWBHRPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S.BrH/c1-2-5-9(6-3-1)12-10-11-7-4-8-13-10;/h1-3,5-6H,4,7-8H2,(H,11,12);1H.
What are the key properties of N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide?
N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide has a molecular weight of 273.20 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-5,6-dihydro-4H-1,3-thiazin-2-amine;hydrobromide is sourced from PubChem (CID 24747414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).