About 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride
4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride (PubChem CID 24747417) has the molecular formula C23H27ClN2O2
and a molecular weight of 398.93 g/mol. Its IUPAC name is 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride |
| PubChem CID | 24747417 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride |
| SMILES | Cc1cc(C)c2c(CN3CCN(Cc4ccccc4)CC3)cc(=O)oc2c1.Cl |
| InChI | InChI=1S/C23H26N2O2.ClH/c1-17-12-18(2)23-20(14-22(26)27-21(23)13-17)16-25-10-8-24(9-11-25)15-19-6-4-3-5-7-19;/h3-7,12-14H,8-11,15-16H2,1-2H3;1H |
| InChIKey | SKSUPBRHLOGPLI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride?
The IUPAC name of 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride (CID 24747417) is 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride.
What is the SMILES notation for 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride?
The canonical SMILES for 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride is Cc1cc(C)c2c(CN3CCN(Cc4ccccc4)CC3)cc(=O)oc2c1.Cl.
What is the InChIKey of 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride?
The InChIKey is SKSUPBRHLOGPLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O2.ClH/c1-17-12-18(2)23-20(14-22(26)27-21(23)13-17)16-25-10-8-24(9-11-25)15-19-6-4-3-5-7-19;/h3-7,12-14H,8-11,15-16H2,1-2H3;1H.
What are the key properties of 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride?
4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride has a molecular weight of 398.93 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-benzylpiperazin-1-yl)methyl]-5,7-dimethylchromen-2-one;hydrochloride is sourced from PubChem (CID 24747417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).