About (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene
(2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene (PubChem CID 24747426) has the molecular formula C26H28O2
and a molecular weight of 372.51 g/mol. Its IUPAC name is (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene |
| PubChem CID | 24747426 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene |
| SMILES | COc1ccc([C@@H]2C[C@@H](c3ccccc3)Oc3c(C)ccc(C(C)C)c32)cc1 |
| InChI | InChI=1S/C26H28O2/c1-17(2)22-15-10-18(3)26-25(22)23(19-11-13-21(27-4)14-12-19)16-24(28-26)20-8-6-5-7-9-20/h5-15,17,23-24H,16H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | SKNHBIKYZAIJSJ-ZEQRLZLVSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene?
The IUPAC name of (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene (CID 24747426) is (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene.
What is the SMILES notation for (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene?
The canonical SMILES for (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene is COc1ccc([C@@H]2C[C@@H](c3ccccc3)Oc3c(C)ccc(C(C)C)c32)cc1.
What is the InChIKey of (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene?
The InChIKey is SKNHBIKYZAIJSJ-ZEQRLZLVSA-N. The full InChI is InChI=1S/C26H28O2/c1-17(2)22-15-10-18(3)26-25(22)23(19-11-13-21(27-4)14-12-19)16-24(28-26)20-8-6-5-7-9-20/h5-15,17,23-24H,16H2,1-4H3/t23-,24-/m0/s1.
What are the key properties of (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene?
(2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene has a molecular weight of 372.51 g/mol, XLogP of 6.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-4-(4-methoxyphenyl)-8-methyl-2-phenyl-5-propan-2-yl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 24747426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).