About ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate
ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (PubChem CID 24747443) has the molecular formula C19H28FNO4S
and a molecular weight of 385.50 g/mol. Its IUPAC name is ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| PubChem CID | 24747443 |
| Molecular Formula | C19H28FNO4S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| SMILES | CCCCCCCCN1[C@@H](CC(=O)OCC)c2cc(F)ccc2S1(=O)=O |
| InChI | InChI=1S/C19H28FNO4S/c1-3-5-6-7-8-9-12-21-17(14-19(22)25-4-2)16-13-15(20)10-11-18(16)26(21,23)24/h10-11,13,17H,3-9,12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | MEYGMGXRZHESBX-KRWDZBQOSA-N |
| XLogP | 4.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The IUPAC name of ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (CID 24747443) is ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
What is the SMILES notation for ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The canonical SMILES for ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate is CCCCCCCCN1[C@@H](CC(=O)OCC)c2cc(F)ccc2S1(=O)=O.
What is the InChIKey of ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The InChIKey is MEYGMGXRZHESBX-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H28FNO4S/c1-3-5-6-7-8-9-12-21-17(14-19(22)25-4-2)16-13-15(20)10-11-18(16)26(21,23)24/h10-11,13,17H,3-9,12,14H2,1-2H3/t17-/m0/s1.
What are the key properties of ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate has a molecular weight of 385.50 g/mol, XLogP of 4.18, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate is sourced from PubChem (CID 24747443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).