C20H28F3NO4S — CID 24747446
ethyl 2-[(3S)-2-octyl-1,1-dioxo-6-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetate (PubChem CID 24747446) has the molecular formula C20H28F3NO4S and a molecular weight of 435.51 g/mol. Its IUPAC name is ethyl 2-[(3S)-2-octyl-1,1-dioxo-6-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[(3S)-2-octyl-1,1-dioxo-6-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 24747446 |
| Molecular Formula | C20H28F3NO4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | ethyl 2-[(3S)-2-octyl-1,1-dioxo-6-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetate |
| SMILES | CCCCCCCCN1[C@@H](CC(=O)OCC)c2ccc(C(F)(F)F)cc2S1(=O)=O |
| InChI | InChI=1S/C20H28F3NO4S/c1-3-5-6-7-8-9-12-24-17(14-19(25)28-4-2)16-11-10-15(20(21,22)23)13-18(16)29(24,26)27/h10-11,13,17H,3-9,12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | IHBVLUJKXJLNFW-KRWDZBQOSA-N |
| XLogP | 5.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|