About ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate
ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (PubChem CID 24747450) has the molecular formula C14H17NO4S
and a molecular weight of 295.36 g/mol. Its IUPAC name is ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| PubChem CID | 24747450 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1c2ccccc2S(=O)(=O)N1C1CC1 |
| InChI | InChI=1S/C14H17NO4S/c1-2-19-14(16)9-12-11-5-3-4-6-13(11)20(17,18)15(12)10-7-8-10/h3-6,10,12H,2,7-9H2,1H3/t12-/m0/s1 |
| InChIKey | SZUVXGNBPBUAKD-LBPRGKRZSA-N |
| XLogP | 1.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The IUPAC name of ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (CID 24747450) is ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
What is the SMILES notation for ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The canonical SMILES for ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate is CCOC(=O)C[C@H]1c2ccccc2S(=O)(=O)N1C1CC1.
What is the InChIKey of ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The InChIKey is SZUVXGNBPBUAKD-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H17NO4S/c1-2-19-14(16)9-12-11-5-3-4-6-13(11)20(17,18)15(12)10-7-8-10/h3-6,10,12H,2,7-9H2,1H3/t12-/m0/s1.
What are the key properties of ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate has a molecular weight of 295.36 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3S)-2-cyclopropyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate is sourced from PubChem (CID 24747450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).