C26H26ClF3N2O4 — CID 24747492
(4aS,8R,8aS)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[(3,4-dimethoxyphenyl)methyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide (PubChem CID 24747492) has the molecular formula C26H26ClF3N2O4 and a molecular weight of 522.95 g/mol. Its IUPAC name is (4aS,8R,8aS)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[(3,4-dimethoxyphenyl)methyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide.
| Compound Name | (4aS,8R,8aS)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[(3,4-dimethoxyphenyl)methyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 24747492 |
| Molecular Formula | C26H26ClF3N2O4 |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | (4aS,8R,8aS)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[(3,4-dimethoxyphenyl)methyl]-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
| SMILES | COc1ccc(CN2CC[C@H]3C=CC[C@@H](C(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)[C@H]3C2=O)cc1OC |
| InChI | InChI=1S/C26H26ClF3N2O4/c1-35-21-9-6-15(12-22(21)36-2)14-32-11-10-16-4-3-5-18(23(16)25(32)34)24(33)31-17-7-8-20(27)19(13-17)26(28,29)30/h3-4,6-9,12-13,16,18,23H,5,10-11,14H2,1-2H3,(H,31,33)/t16-,18-,23+/m1/s1 |
| InChIKey | CKTQSZLJZDVMBM-UQNRQAKVSA-N |
| XLogP | 5.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|