C19H26F3NO4S — CID 24747501
methyl 2-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetate (PubChem CID 24747501) has the molecular formula C19H26F3NO4S and a molecular weight of 421.48 g/mol. Its IUPAC name is methyl 2-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 24747501 |
| Molecular Formula | C19H26F3NO4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | methyl 2-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetate |
| SMILES | CCCCCCCCN1[C@@H](CC(=O)OC)c2cc(C(F)(F)F)ccc2S1(=O)=O |
| InChI | InChI=1S/C19H26F3NO4S/c1-3-4-5-6-7-8-11-23-16(13-18(24)27-2)15-12-14(19(20,21)22)9-10-17(15)28(23,25)26/h9-10,12,16H,3-8,11,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | ZGBFGBUJYMCPHH-INIZCTEOSA-N |
| XLogP | 4.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|