C22H34N2O2 — CID 24747505
(4aS,8R,8aS)-N,2-dicyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide (PubChem CID 24747505) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (4aS,8R,8aS)-N,2-dicyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide.
| Compound Name | (4aS,8R,8aS)-N,2-dicyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 24747505 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (4aS,8R,8aS)-N,2-dicyclohexyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1CC=C[C@@H]2CCN(C3CCCCC3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C22H34N2O2/c25-21(23-17-9-3-1-4-10-17)19-13-7-8-16-14-15-24(22(26)20(16)19)18-11-5-2-6-12-18/h7-8,16-20H,1-6,9-15H2,(H,23,25)/t16-,19-,20+/m1/s1 |
| InChIKey | RNDUBZLYEVOMSR-AHRSYUTCSA-N |
| XLogP | 3.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|