C27H31N3O2 — CID 24747512
(4aS,8R,8aS)-2-benzyl-8-(4-phenylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one (PubChem CID 24747512) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is (4aS,8R,8aS)-2-benzyl-8-(4-phenylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one.
| Compound Name | (4aS,8R,8aS)-2-benzyl-8-(4-phenylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 24747512 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (4aS,8R,8aS)-2-benzyl-8-(4-phenylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one |
| SMILES | O=C1[C@H]2[C@H](C=CC[C@H]2C(=O)N2CCN(c3ccccc3)CC2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C27H31N3O2/c31-26(29-18-16-28(17-19-29)23-11-5-2-6-12-23)24-13-7-10-22-14-15-30(27(32)25(22)24)20-21-8-3-1-4-9-21/h1-12,22,24-25H,13-20H2/t22-,24-,25+/m1/s1 |
| InChIKey | WQKLKJKVWBVHIK-GPXOXTDOSA-N |
| XLogP | 3.58 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|