C19H26F3NO3S — CID 24747525
1-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]propan-2-one (PubChem CID 24747525) has the molecular formula C19H26F3NO3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]propan-2-one.
| Compound Name | 1-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]propan-2-one |
|---|---|
| PubChem CID | 24747525 |
| Molecular Formula | C19H26F3NO3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]propan-2-one |
| SMILES | CCCCCCCCN1[C@@H](CC(C)=O)c2cc(C(F)(F)F)ccc2S1(=O)=O |
| InChI | InChI=1S/C19H26F3NO3S/c1-3-4-5-6-7-8-11-23-17(12-14(2)24)16-13-15(19(20,21)22)9-10-18(16)27(23,25)26/h9-10,13,17H,3-8,11-12H2,1-2H3/t17-/m0/s1 |
| InChIKey | OHADQTKDZDQGCY-KRWDZBQOSA-N |
| XLogP | 5.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|