About 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid
2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid (PubChem CID 24747564) has the molecular formula C16H14FNO4S
and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid |
| PubChem CID | 24747564 |
| Molecular Formula | C16H14FNO4S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1c2cc(F)ccc2S(=O)(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H14FNO4S/c17-12-6-7-15-13(8-12)14(9-16(19)20)18(23(15,21)22)10-11-4-2-1-3-5-11/h1-8,14H,9-10H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | KBSIPXIDANTCML-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid?
The IUPAC name of 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid (CID 24747564) is 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid.
What is the SMILES notation for 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid?
The canonical SMILES for 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid is O=C(O)C[C@H]1c2cc(F)ccc2S(=O)(=O)N1Cc1ccccc1.
What is the InChIKey of 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid?
The InChIKey is KBSIPXIDANTCML-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H14FNO4S/c17-12-6-7-15-13(8-12)14(9-16(19)20)18(23(15,21)22)10-11-4-2-1-3-5-11/h1-8,14H,9-10H2,(H,19,20)/t14-/m0/s1.
What are the key properties of 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid?
2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid has a molecular weight of 335.36 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-2-benzyl-5-fluoro-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetic acid is sourced from PubChem (CID 24747564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).