About methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate
methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (PubChem CID 24747566) has the molecular formula C18H26FNO4S
and a molecular weight of 371.47 g/mol. Its IUPAC name is methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| PubChem CID | 24747566 |
| Molecular Formula | C18H26FNO4S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate |
| SMILES | CCCCCCCCN1[C@@H](CC(=O)OC)c2cc(F)ccc2S1(=O)=O |
| InChI | InChI=1S/C18H26FNO4S/c1-3-4-5-6-7-8-11-20-16(13-18(21)24-2)15-12-14(19)9-10-17(15)25(20,22)23/h9-10,12,16H,3-8,11,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | ODTXYTYCQSTZMJ-INIZCTEOSA-N |
| XLogP | 3.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The IUPAC name of methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate (CID 24747566) is methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate.
What is the SMILES notation for methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The canonical SMILES for methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate is CCCCCCCCN1[C@@H](CC(=O)OC)c2cc(F)ccc2S1(=O)=O.
What is the InChIKey of methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
The InChIKey is ODTXYTYCQSTZMJ-INIZCTEOSA-N. The full InChI is InChI=1S/C18H26FNO4S/c1-3-4-5-6-7-8-11-20-16(13-18(21)24-2)15-12-14(19)9-10-17(15)25(20,22)23/h9-10,12,16H,3-8,11,13H2,1-2H3/t16-/m0/s1.
What are the key properties of methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate?
methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate has a molecular weight of 371.47 g/mol, XLogP of 3.79, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3S)-5-fluoro-2-octyl-1,1-dioxo-3H-1,2-benzothiazol-3-yl]acetate is sourced from PubChem (CID 24747566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).