C21H25NO9 — CID 24747582
2-(1,3-benzodioxol-5-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;oxalic acid (PubChem CID 24747582) has the molecular formula C21H25NO9 and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;oxalic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 24747582 |
| Molecular Formula | C21H25NO9 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;oxalic acid |
| SMILES | COc1cc(OC)c(OC)cc1CNCCc1ccc2c(c1)OCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H23NO5.C2H2O4/c1-21-16-10-18(23-3)17(22-2)9-14(16)11-20-7-6-13-4-5-15-19(8-13)25-12-24-15;3-1(4)2(5)6/h4-5,8-10,20H,6-7,11-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | AEZWUSOSXDIWEC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|