About 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride
1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride (PubChem CID 24747592) has the molecular formula C19H33ClN2O3
and a molecular weight of 372.94 g/mol. Its IUPAC name is 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride |
| PubChem CID | 24747592 |
| Molecular Formula | C19H33ClN2O3 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride |
| SMILES | COc1cccc(OC)c1OCCCCCCN1CCN(C)CC1.Cl |
| InChI | InChI=1S/C19H32N2O3.ClH/c1-20-12-14-21(15-13-20)11-6-4-5-7-16-24-19-17(22-2)9-8-10-18(19)23-3;/h8-10H,4-7,11-16H2,1-3H3;1H |
| InChIKey | ULPBXMMZNACKAL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride?
The IUPAC name of 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride (CID 24747592) is 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride.
What is the SMILES notation for 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride?
The canonical SMILES for 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride is COc1cccc(OC)c1OCCCCCCN1CCN(C)CC1.Cl.
What is the InChIKey of 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride?
The InChIKey is ULPBXMMZNACKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O3.ClH/c1-20-12-14-21(15-13-20)11-6-4-5-7-16-24-19-17(22-2)9-8-10-18(19)23-3;/h8-10H,4-7,11-16H2,1-3H3;1H.
What are the key properties of 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride?
1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride has a molecular weight of 372.94 g/mol, XLogP of 3.31, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-methylpiperazine;hydrochloride is sourced from PubChem (CID 24747592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).